Difference between revisions of "Co-chaperone-SP-2Fe2S-Complex"

Latest revision as of 19:16, 21 March 2018

"a [co-chaperone]-[scaffold protein-(2Fe-2S)] complex" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Co-chaperone-SP-2Fe2S-Complex Co-chaperone-SP-2Fe2S-Complex] ==
-* smiles:
-** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
-* inchi key:
-** InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
 * common name:
-** bisorganyltrisulfane
+** a [co-chaperone]-[scaffold protein-(2Fe-2S)] complex
-* molecular weight:
-** 644.686
 * Synonym(s):
-** GS3G
 == Reaction(s) known to consume the compound ==
+* [[RXN-14389]]
 == Reaction(s) known to produce the compound ==
+* [[RXN-14388]]
 == Reaction(s) of unknown directionality ==
-* [[RXN-10851]]
 == External links  ==
-* PUBCHEM:
+{{#set: common name=a [co-chaperone]-[scaffold protein-(2Fe-2S)] complex}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479371 45479371]
+{{#set: consumed by=RXN-14389}}
-{{#set: smiles=C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O}}
+{{#set: produced by=RXN-14388}}
-{{#set: inchi key=InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L}}
-{{#set: common name=bisorganyltrisulfane}}
-{{#set: molecular weight=644.686    }}
-{{#set: common name=GS3G}}
-{{#set: consumed or produced by=RXN-10851}}