Difference between revisions of "Tiso gene 17423"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] == * smiles: ** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
 
(Created page with "Category:Gene == Gene Tiso_gene_17423 == * right end position: ** 2715 * transcription direction: ** POSITIVE * left end position: ** 528 * centisome position: ** 14.22797...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] ==
+
== Gene Tiso_gene_17423 ==
−
* smiles:
+
* right end position:
−
** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2715
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (2E,11Z)-octadecenoyl-CoA
+
** 528
−
* molecular weight:
+
* centisome position:
−
** 1025.937    
+
** 14.227971    
 
* Synonym(s):
 
* Synonym(s):
−
** 18:2-Δ2,Δ11-CoA
 
−
** 2-trans,11-cis-octadecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-15556]]
−
* [[RXN-17784]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=2715}}
−
{{#set: inchi key=InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=(2E,11Z)-octadecenoyl-CoA}}
+
{{#set: left end position=528}}
−
{{#set: molecular weight=1025.937   }}
+
{{#set: centisome position=14.227971   }}
−
{{#set: common name=18:2-Δ2,Δ11-CoA|2-trans,11-cis-octadecenoyl-CoA}}
+
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
{{#set: produced by=RXN-17784}}
+
{{#set: pathway associated=PWY-7511}}

Latest revision as of 19:14, 21 March 2018

Gene Tiso_gene_17423

  • right end position:
    • 2715
  • transcription direction:
    • POSITIVE
  • left end position:
    • 528
  • centisome position:
    • 14.227971
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17423&oldid=40351"