Difference between revisions of "Carboxylic-esters"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] == * smiles: ** C1(O)(C(O)C(OP(=O)([O-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carboxylic-esters Carboxylic-esters] == * common name: ** a carboxylic ester * Synonym(s): ==...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSITOL-1-3-4-TRIPHOSPHATE INOSITOL-1-3-4-TRIPHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Carboxylic-esters Carboxylic-esters] ==
* smiles:
+
** C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)
+
* inchi key:
+
** InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H
+
 
* common name:
 
* common name:
** D-myo-inositol (1,3,4)-trisphosphate
+
** a carboxylic ester
* molecular weight:
+
** 414.049   
+
 
* Synonym(s):
 
* Synonym(s):
** Ins(1,3,4)P3
 
** 1-D-myo-inositol (1,3,4)-trisphosphate
 
** inositol 1,3,4-trisphosphate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.139-RXN]]
+
* [[CARBOXYLESTERASE-RXN]]
* [[RXN-10959]]
+
* [[RXN-10939]]
+
* [[2.7.1.133-RXN]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8730]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=a carboxylic ester}}
** [http://www.genome.jp/dbget-bin/www_bget?C01243 C01243]
+
{{#set: consumed by=CARBOXYLESTERASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58414 58414]
+
* METABOLIGHTS : MTBLC58414
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201948 25201948]
+
* HMDB : HMDB01143
+
{{#set: smiles=C1(O)(C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)C(OP([O-])([O-])=O)1)}}
+
{{#set: inchi key=InChIKey=MMWCIQZXVOZEGG-MLQGYMEPSA-H}}
+
{{#set: common name=D-myo-inositol (1,3,4)-trisphosphate}}
+
{{#set: molecular weight=414.049    }}
+
{{#set: common name=Ins(1,3,4)P3|1-D-myo-inositol (1,3,4)-trisphosphate|inositol 1,3,4-trisphosphate}}
+
{{#set: consumed by=2.7.1.139-RXN|RXN-10959|RXN-10939|2.7.1.133-RXN}}
+
{{#set: produced by=RXN-8730}}
+

Latest revision as of 19:18, 21 March 2018

Metabolite Carboxylic-esters

  • common name:
    • a carboxylic ester
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links