Difference between revisions of "PWY-6002"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] == * smiles: ** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1) * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6002 PWY-6002] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3465 TAX-34...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6002 PWY-6002] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3465 TAX-3465] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4004 TAX-4004] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3977 TAX-3977] | ||
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4210 TAX-4210] | ||
* common name: | * common name: | ||
| − | ** | + | ** lotaustralin degradation |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''2''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[RXN-9674]] |
| − | * [ | + | ** 14 associated gene(s): |
| + | *** [[Tiso_gene_15066]] | ||
| + | *** [[Tiso_gene_13306]] | ||
| + | *** [[Tiso_gene_3467]] | ||
| + | *** [[Tiso_gene_2344]] | ||
| + | *** [[Tiso_gene_6497]] | ||
| + | *** [[Tiso_gene_8669]] | ||
| + | *** [[Tiso_gene_2843]] | ||
| + | *** [[Tiso_gene_6007]] | ||
| + | *** [[Tiso_gene_10001]] | ||
| + | *** [[Tiso_gene_6188]] | ||
| + | *** [[Tiso_gene_13305]] | ||
| + | *** [[Tiso_gene_6187]] | ||
| + | *** [[Tiso_gene_15067]] | ||
| + | *** [[Tiso_gene_5836]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11733 RXN-11733] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-3465}} | |
| − | + | {{#set: taxonomic range=TAX-4004}} | |
| − | + | {{#set: taxonomic range=TAX-3803}} | |
| − | + | {{#set: taxonomic range=TAX-3977}} | |
| − | + | {{#set: taxonomic range=TAX-4210}} | |
| − | + | {{#set: common name=lotaustralin degradation}} | |
| − | + | {{#set: reaction found=1}} | |
| − | {{#set: | + | {{#set: total reaction=2}} |
| − | {{#set: | + | {{#set: completion rate=50.0}} |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:18, 21 March 2018
Pathway PWY-6002
- taxonomic range:
- common name:
- lotaustralin degradation
- Synonym(s):
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- RXN-9674
- 14 associated gene(s):
- 3 reconstruction source(s) associated:
