Difference between revisions of "PWY-6917"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE] == * smiles: **...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6917 PWY-6917] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6917 PWY-6917] ==
* smiles:
+
* taxonomic range:
** C[S+](CCC(C([O-])=O)=O)CC1(OC(C(C1O)O)N3(C2(=NC=NC(=C2N=C3)N)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=UOKVQQMBGVMXPU-CJPDYEHRSA-N
+
 
* common name:
 
* common name:
** S-adenosyl-4-methylthio-2-oxobutanoate
+
** vernolate biosynthesis III
* molecular weight:
+
** 397.405   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** oat seed peroxygenase pathway
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[LINOLEOYL-RXN]]
* [[DAPASYN-RXN]]
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_801]]
 +
*** [[Tiso_gene_7477]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16219 RXN-16219]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8497 RXN-8497]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459852 5459852]
+
{{#set: common name=vernolate biosynthesis III}}
* CHEMSPIDER:
+
{{#set: common name=oat seed peroxygenase pathway}}
** [http://www.chemspider.com/Chemical-Structure.4573603.html 4573603]
+
{{#set: reaction found=1}}
* CHEBI:
+
{{#set: total reaction=3}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16490 16490]
+
{{#set: completion rate=33.0}}
* BIGG : amob
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04425 C04425]
+
{{#set: smiles=C[S+](CCC(C([O-])=O)=O)CC1(OC(C(C1O)O)N3(C2(=NC=NC(=C2N=C3)N)))}}
+
{{#set: inchi key=InChIKey=UOKVQQMBGVMXPU-CJPDYEHRSA-N}}
+
{{#set: common name=S-adenosyl-4-methylthio-2-oxobutanoate}}
+
{{#set: molecular weight=397.405    }}
+
{{#set: consumed or produced by=DAPASYN-RXN}}
+

Latest revision as of 19:20, 21 March 2018

Pathway PWY-6917

  • taxonomic range:
  • common name:
    • vernolate biosynthesis III
  • Synonym(s):
    • oat seed peroxygenase pathway

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links