Difference between revisions of "CPDQT-28"

Latest revision as of 19:23, 21 March 2018

"CSCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_8413 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] ==
+* smiles:
+** CSCCCCCC(=O)C([O-])=O
+* common name:
+** 7-(methylthio)-2-oxoheptanoate
+* inchi key:
+** InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M
+* molecular weight:
+** 189.249
 * Synonym(s):
+** 7-(methylthio)-2-oxoheptanoic acid
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[PROTEIN-KINASE-RXN]]
+== Reaction(s) known to produce the compound ==
-** [[pantograph]]-[[esiliculosus]]
+* [[RXNQT-4168]]
-== Pathways associated ==
+* [[RXN-18207]]
+== Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+* PUBCHEM:
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237184 44237184]
+* KNAPSACK : C00007645
+{{#set: smiles=CSCCCCCC(=O)C([O-])=O}}
+{{#set: common name=7-(methylthio)-2-oxoheptanoate}}
+{{#set: inchi key=InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M}}
+{{#set: molecular weight=189.249    }}
+{{#set: common name=7-(methylthio)-2-oxoheptanoic acid}}
+{{#set: produced by=RXNQT-4168|RXN-18207}}