Difference between revisions of "PWY-7674"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] == * smiles: ** C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2) * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7674 PWY-7674] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-267890 TAX-...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7674 PWY-7674] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-267890 TAX-267890] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** CMP-8-amino-3,8-dideoxy-D-manno-octulosonate biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** CMP-Kdo8N biosynthesis I |
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''1''' reactions found over '''7''' reactions in the full pathway |
− | == Reaction(s) | + | * [[KDO-8PSYNTH-RXN]] |
− | == | + | ** 2 associated gene(s): |
+ | *** [[Tiso_gene_1350]] | ||
+ | *** [[Tiso_gene_20348]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=DARAB5PISOM-RXN DARAB5PISOM-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=KDO-8PPHOSPHAT-RXN KDO-8PPHOSPHAT-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16746 RXN-16746] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16747 RXN-16747] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16748 RXN-16748] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16804 RXN-16804] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-267890}} | |
− | + | {{#set: common name=CMP-8-amino-3,8-dideoxy-D-manno-octulosonate biosynthesis}} | |
− | + | {{#set: common name=CMP-Kdo8N biosynthesis I}} | |
− | + | {{#set: reaction found=1}} | |
− | {{#set: | + | {{#set: total reaction=7}} |
− | {{#set: | + | {{#set: completion rate=14.0}} |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:23, 21 March 2018
Pathway PWY-7674
- taxonomic range:
- common name:
- CMP-8-amino-3,8-dideoxy-D-manno-octulosonate biosynthesis
- Synonym(s):
- CMP-Kdo8N biosynthesis I
Reaction(s) found
1 reactions found over 7 reactions in the full pathway
- KDO-8PSYNTH-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated: