Difference between revisions of "RXN-12871"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] == * smiles: ** C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=HEBKCHPVOIAQTA-ZXF...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12871 RXN-12871] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12871 RXN-12871] ==
* smiles:
+
* direction:
** C(O)C(O)C(O)C(O)CO
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N
+
* common name:
+
** ribitol
+
* molecular weight:
+
** 152.147   
+
 
* Synonym(s):
 
* Synonym(s):
** meso-ribitol
 
** adonitol
 
** (2R,3s,4S)-pentane-1,2,3,4,5-pentol
 
** D-ribitol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-13913]][c] '''=>''' 1 [[CPD-13912]][c] '''+''' 1 [[PROTON]][c]
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 2-carboxy-L-xylonolactone[c] '''=>''' 1 2-carboxy-L-threo-pentonate[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-6959]], L-ascorbate degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6959 PWY-6959]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 488-81-3
+
{{#set: direction=LEFT-TO-RIGHT}}
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6959}}
** [http://www.genome.jp/dbget-bin/www_bget?C00474 C00474]
+
{{#set: reconstruction category=annotation}}
* CHEBI:
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15963 15963]
+
{{#set: reconstruction tool=pathwaytools}}
* METABOLIGHTS : MTBLC15963
+
* HMDB : HMDB00508
+
{{#set: smiles=C(O)C(O)C(O)C(O)CO}}
+
{{#set: inchi key=InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N}}
+
{{#set: common name=ribitol}}
+
{{#set: molecular weight=152.147    }}
+
{{#set: common name=meso-ribitol|adonitol|(2R,3s,4S)-pentane-1,2,3,4,5-pentol|D-ribitol}}
+
{{#set: consumed or produced by=RIBITOL-2-DEHYDROGENASE-RXN}}
+

Latest revision as of 19:25, 21 March 2018

Reaction RXN-12871

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 2-carboxy-L-xylonolactone[c] => 1 2-carboxy-L-threo-pentonate[c] + 1 H+[c]

Genes associated with this reaction

Pathways

  • PWY-6959, L-ascorbate degradation V: PWY-6959
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links