Difference between revisions of "CPDQT-36"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4419 == * left end position: ** 11596 * transcription direction: ** POSITIVE * right end position: ** 14296 * centisome position: ** 63.536...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-36 CPDQT-36] == * smiles: ** C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-] * common name: ** 3-(3'-met...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-36 CPDQT-36] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-] |
| − | * | + | * common name: |
| − | ** | + | ** 3-(3'-methylthio)propylmalate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SQXVIIOPMYSNCP-UHFFFAOYSA-L |
| − | * | + | * molecular weight: |
| − | ** | + | ** 220.24 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-(3'-methylthio)propylmalic acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXNQT-4165]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[RXN- | + | * [[RXN-18208]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237292 44237292] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=133501 133501] |
| − | {{#set: | + | {{#set: smiles=C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-]}} |
| + | {{#set: common name=3-(3'-methylthio)propylmalate}} | ||
| + | {{#set: inchi key=InChIKey=SQXVIIOPMYSNCP-UHFFFAOYSA-L}} | ||
| + | {{#set: molecular weight=220.24 }} | ||
| + | {{#set: common name=3-(3'-methylthio)propylmalic acid}} | ||
| + | {{#set: consumed by=RXNQT-4165}} | ||
| + | {{#set: reversible reaction associated=RXN-18208}} | ||
Latest revision as of 19:28, 21 March 2018
Contents
Metabolite CPDQT-36
- smiles:
- C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-]
- common name:
- 3-(3'-methylthio)propylmalate
- inchi key:
- InChIKey=SQXVIIOPMYSNCP-UHFFFAOYSA-L
- molecular weight:
- 220.24
- Synonym(s):
- 3-(3'-methylthio)propylmalic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-" cannot be used as a page name in this wiki.
