Difference between revisions of "Dihydroquercetins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] == * smiles: ** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dihydroquercetins Dihydroquercetins] == * common name: ** taxifolin * Synonym(s): ** a cis or t...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dihydroquercetins Dihydroquercetins] ==
* smiles:
+
** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)
+
* inchi key:
+
** InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M
+
 
* common name:
 
* common name:
** thyroxine sulfate
+
** taxifolin
* molecular weight:
+
** 855.924   
+
 
* Synonym(s):
 
* Synonym(s):
** T4 sulfate
+
** a cis or trans dihydroquercetin
** thyroxine-4-sulfate
+
** dihydroquercetin
** L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10614]]
+
* [[1.14.11.19-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=taxifolin}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657726 90657726]
+
{{#set: common name=a cis or trans dihydroquercetin|dihydroquercetin}}
* CHEBI:
+
{{#set: produced by=1.14.11.19-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58910 58910]
+
{{#set: smiles=C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)}}
+
{{#set: inchi key=InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M}}
+
{{#set: common name=thyroxine sulfate}}
+
{{#set: molecular weight=855.924    }}
+
{{#set: common name=T4 sulfate|thyroxine-4-sulfate|L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-}}
+
{{#set: produced by=RXN-10614}}
+

Latest revision as of 19:32, 21 March 2018

Metabolite Dihydroquercetins

  • common name:
    • taxifolin
  • Synonym(s):
    • a cis or trans dihydroquercetin
    • dihydroquercetin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links