Difference between revisions of "PWY-6415"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] == * smiles: ** [CH](=O)CCCC([N+])C(=O)[O-] * inchi key: ** InChIKey=GFXYTQP...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6415 PWY-6415] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3038 TAX-30...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6415 PWY-6415] == |
− | * | + | * taxonomic range: |
− | ** [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3038 TAX-3038] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** L-ascorbate biosynthesis V |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | + | ** L-ascorbic acid biosynthesis V | |
− | ** L- | + | ** vitamin c biosynthesis |
− | ** | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''2''' reactions found over '''11''' reactions in the full pathway |
− | + | * [[PWY-7343]] | |
− | * [[1 | + | ** 0 associated gene: |
− | == Reaction(s) | + | * [[UDP-GLUCURONATE-4-EPIMERASE-RXN]] |
− | * [[ | + | ** 1 associated gene(s): |
− | * [[RXN- | + | *** [[Tiso_gene_12322]] |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PWY-7346 PWY-7346] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PWY-7346 PWY-7346] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11147 RXN-11147] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11150 RXN-11150] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11151 RXN-11151] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11152 RXN-11152] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11153 RXN-11153] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14753 RXN-14753] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-3038}} | |
− | + | {{#set: common name=L-ascorbate biosynthesis V}} | |
− | + | {{#set: common name=L-ascorbic acid biosynthesis V|vitamin c biosynthesis}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=11}} | |
− | + | {{#set: completion rate=18.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:35, 21 March 2018
Pathway PWY-6415
- taxonomic range:
- common name:
- L-ascorbate biosynthesis V
- Synonym(s):
- L-ascorbic acid biosynthesis V
- vitamin c biosynthesis
Reaction(s) found
2 reactions found over 11 reactions in the full pathway
- PWY-7343
- 0 associated gene:
- UDP-GLUCURONATE-4-EPIMERASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated: