Difference between revisions of "CPD-17932"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNOSINE CARNOSINE] == * smiles: ** C(CC(=O)NC(CC1(=CNC=N1))C([O-])=O)[N+] * inchi key: ** InC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17932 CPD-17932] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17932 CPD-17932] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC4(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC([N+])C([O-])=O)C(NC(C)C(=O)NC(C([O-])=O)CCCC(C(NC(C)C([O-])=O)=O)NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC2(C(OC1(OC(CO)C(O[R3])C(O)C(NC(=O)C)1))C(CO)OC(C(NC(=O)C)2)O[R2]))=O)C(OC3(OC(CO)C(O[R1])C(O)C(NC(=O)C)3))C(CO)O4))([O-])=O)C)C)C)C)C)C)C |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a nascent peptidoglycan with D,D cross-links (meso-diaminopimelate containing) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16659]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819739 91819739] |
| − | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC4(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC([N+])C([O-])=O)C(NC(C)C(=O)NC(C([O-])=O)CCCC(C(NC(C)C([O-])=O)=O)NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC2(C(OC1(OC(CO)C(O[R3])C(O)C(NC(=O)C)1))C(CO)OC(C(NC(=O)C)2)O[R2]))=O)C(OC3(OC(CO)C(O[R1])C(O)C(NC(=O)C)3))C(CO)O4))([O-])=O)C)C)C)C)C)C)C}} | |
| − | {{#set: smiles=C( | + | {{#set: common name=a nascent peptidoglycan with D,D cross-links (meso-diaminopimelate containing)}} |
| − | + | {{#set: produced by=RXN-16659}} | |
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: produced by= | + | |
Latest revision as of 19:38, 21 March 2018
Contents
Metabolite CPD-17932
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC4(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC([N+])C([O-])=O)C(NC(C)C(=O)NC(C([O-])=O)CCCC(C(NC(C)C([O-])=O)=O)NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC2(C(OC1(OC(CO)C(O[R3])C(O)C(NC(=O)C)1))C(CO)OC(C(NC(=O)C)2)O[R2]))=O)C(OC3(OC(CO)C(O[R1])C(O)C(NC(=O)C)3))C(CO)O4))([O-])=O)C)C)C)C)C)C)C
- common name:
- a nascent peptidoglycan with D,D cross-links (meso-diaminopimelate containing)
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)OC4(C(NC(=O)C)C(OC(C)C(=O)NC(C)C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC([N+])C([O-])=O)C(NC(C)C(=O)NC(C([O-])=O)CCCC(C(NC(C)C([O-])=O)=O)NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC2(C(OC1(OC(CO)C(O[R3])C(O)C(NC(=O)C)1))C(CO)OC(C(NC(=O)C)2)O[R2]))=O)C(OC3(OC(CO)C(O[R1])C(O)C(NC(=O)C)3))C(CO)O4))([O-])=O)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.
