Difference between revisions of "CPD0-2189"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASP-tRNAs ASP-tRNAs] == * common name: ** tRNAasp * Synonym(s): ** TRNA(ASP) == Reaction(s) kn...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] == * smiles: ** C(O)C(O)C([N+])C(=O)[O-] * common name: ** 4-hydroxy-L-thr...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] == |
| + | * smiles: | ||
| + | ** C(O)C(O)C([N+])C(=O)[O-] | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-hydroxy-L-threonine |
| + | * inchi key: | ||
| + | ** InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N | ||
| + | * molecular weight: | ||
| + | ** 135.119 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (2S,3S)-2-amino-3,4-dihydroxybutanoic acid |
| + | ** hydroxythreonine | ||
| + | ** 3-hydroxyhomoserine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14125]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 21768-45-6 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852420 49852420] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C06056 C06056] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.167988.html 167988] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60904 60904] | ||
| + | * BIGG : 4hthr | ||
| + | {{#set: smiles=C(O)C(O)C([N+])C(=O)[O-]}} | ||
| + | {{#set: common name=4-hydroxy-L-threonine}} | ||
| + | {{#set: inchi key=InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N}} | ||
| + | {{#set: molecular weight=135.119 }} | ||
| + | {{#set: common name=(2S,3S)-2-amino-3,4-dihydroxybutanoic acid|hydroxythreonine|3-hydroxyhomoserine}} | ||
| + | {{#set: produced by=RXN-14125}} | ||
Latest revision as of 19:40, 21 March 2018
Contents
Metabolite CPD0-2189
- smiles:
- C(O)C(O)C([N+])C(=O)[O-]
- common name:
- 4-hydroxy-L-threonine
- inchi key:
- InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N
- molecular weight:
- 135.119
- Synonym(s):
- (2S,3S)-2-amino-3,4-dihydroxybutanoic acid
- hydroxythreonine
- 3-hydroxyhomoserine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)C([N+])C(=O)[O-" cannot be used as a page name in this wiki.
