Difference between revisions of "RXN-11989"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORISMATE ISOCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C=CC=C(C1O)C([O-])=O) * inchi ke...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11989 RXN-11989] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOCHORISMATE ISOCHORISMATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11989 RXN-11989] ==
−
* smiles:
+
* direction:
−
** C=C(C(=O)[O-])OC1(C=CC=C(C1O)C([O-])=O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=NTGWPRCCOQCMGE-YUMQZZPRSA-L
+
** [http://enzyme.expasy.org/EC/1.13.11.59 EC-1.13.11.59]
−
* common name:
+
−
** isochorismate
+
−
* molecular weight:
+
−
** 224.17   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Isochorismic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[2.5.1.64-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-7953]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-12935]][c] '''+''' 1 [[PRENAL]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[ISOCHORSYN-RXN]]
+
** 1 torulene[c] '''+''' 1 oxygen[c] '''=>''' 1 4'-apo-β-carotenal[c] '''+''' 1 3-methyl-2-butenal[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4653]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_7740]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6681]], neurosporaxanthin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6681 PWY-6681]
 +
** '''2''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 22642-82-6
+
* RHEA:
−
* DRUGBANK : DB02793
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31522 31522]
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460580 5460580]
+
{{#set: ec number=EC-1.13.11.59}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_4653|Tiso_gene_7740}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00885 C00885]
+
{{#set: in pathway=PWY-6681}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.chemspider.com/Chemical-Structure.4574080.html 4574080]
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29780 29780]
+
−
* BIGG : ichor
+
−
{{#set: smiles=C=C(C(=O)[O-])OC1(C=CC=C(C1O)C([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=NTGWPRCCOQCMGE-YUMQZZPRSA-L}}
+
−
{{#set: common name=isochorismate}}
+
−
{{#set: molecular weight=224.17    }}
+
−
{{#set: common name=Isochorismic acid}}
+
−
{{#set: consumed by=2.5.1.64-RXN}}
+
−
{{#set: consumed or produced by=ISOCHORSYN-RXN}}
+

Latest revision as of 19:42, 21 March 2018

Reaction RXN-11989

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 torulene[c] + 1 oxygen[c] => 1 4'-apo-β-carotenal[c] + 1 3-methyl-2-butenal[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6681, neurosporaxanthin biosynthesis: PWY-6681
    • 2 reactions found over 7 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-11989&oldid=43293"