Difference between revisions of "RXN-14278"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * inchi key...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14278 RXN-14278] == * direction: ** REVERSIBLE * common name: ** hexanoyl-CoA dehydrogenase **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14278 RXN-14278] ==
* smiles:
+
* direction:
** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
+
** REVERSIBLE
* inchi key:
+
** InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** N-acetyl-serotonin sulfate
+
** hexanoyl-CoA dehydrogenase
* molecular weight:
+
** acyl-_dehydrogenase
** 297.305   
+
** acyl-coenzyme_a_oxidase
 +
** ORF
 +
** acyl-CoA_dehydrogenase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.8.7 EC-1.3.8.7]
 
* Synonym(s):
 
* Synonym(s):
** N-acetyl-5-hydroxytryptamine sulfate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-11059]]
+
** 1 [[HEXANOYL-COA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ETF-Oxidized]][c] '''<=>''' 1 [[ETF-Reduced]][c] '''+''' 1 [[CPD0-2121]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 hexanoyl-CoA[c] '''+''' 1 H+[c] '''+''' 1 an oxidized electron-transfer flavoprotein[c] '''<=>''' 1 a reduced electron-transfer flavoprotein[c] '''+''' 1 trans-hex-2-enoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6475]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14511]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_883]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_17967]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_16631]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_18566]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_5991]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_8272]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102514958 102514958]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31208 31208]
* HMDB : HMDB60834
+
* LIGAND-RXN:
{{#set: smiles=CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R04751 R04751]
{{#set: inchi key=InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M}}
+
{{#set: direction=REVERSIBLE}}
{{#set: common name=N-acetyl-serotonin sulfate}}
+
{{#set: common name=hexanoyl-CoA dehydrogenase}}
{{#set: molecular weight=297.305    }}
+
{{#set: common name=acyl-_dehydrogenase}}
{{#set: common name=N-acetyl-5-hydroxytryptamine sulfate}}
+
{{#set: common name=acyl-coenzyme_a_oxidase}}
{{#set: produced by=RXN-11059}}
+
{{#set: common name=ORF}}
 +
{{#set: common name=acyl-CoA_dehydrogenase}}
 +
{{#set: ec number=EC-1.3.8.7}}
 +
{{#set: gene associated=Tiso_gene_6475|Tiso_gene_14511|Tiso_gene_883|Tiso_gene_17967|Tiso_gene_16631|Tiso_gene_18566|Tiso_gene_5991|Tiso_gene_8272}}
 +
{{#set: in pathway=}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 19:43, 21 March 2018

Reaction RXN-14278

  • direction:
    • REVERSIBLE
  • common name:
    • hexanoyl-CoA dehydrogenase
    • acyl-_dehydrogenase
    • acyl-coenzyme_a_oxidase
    • ORF
    • acyl-CoA_dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 hexanoyl-CoA[c] + 1 H+[c] + 1 an oxidized electron-transfer flavoprotein[c] <=> 1 a reduced electron-transfer flavoprotein[c] + 1 trans-hex-2-enoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links