Difference between revisions of "RXN-14278"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14278 RXN-14278] == * direction: ** REVERSIBLE * common name: ** hexanoyl-CoA dehydrogenase **...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14278 RXN-14278] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** hexanoyl-CoA dehydrogenase |
− | * | + | ** acyl-_dehydrogenase |
− | ** | + | ** acyl-coenzyme_a_oxidase |
+ | ** ORF | ||
+ | ** acyl-CoA_dehydrogenase | ||
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/1.3.8.7 EC-1.3.8.7] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[HEXANOYL-COA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ETF-Oxidized]][c] '''<=>''' 1 [[ETF-Reduced]][c] '''+''' 1 [[CPD0-2121]][c] |
− | == | + | * With common name(s): |
+ | ** 1 hexanoyl-CoA[c] '''+''' 1 H+[c] '''+''' 1 an oxidized electron-transfer flavoprotein[c] '''<=>''' 1 a reduced electron-transfer flavoprotein[c] '''+''' 1 trans-hex-2-enoyl-CoA[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_6475]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_14511]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_883]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_17967]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_16631]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_18566]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_5991]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_8272]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31208 31208] |
− | * | + | * LIGAND-RXN: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04751 R04751] |
− | {{#set: | + | {{#set: direction=REVERSIBLE}} |
− | {{#set: common name= | + | {{#set: common name=hexanoyl-CoA dehydrogenase}} |
− | {{#set: | + | {{#set: common name=acyl-_dehydrogenase}} |
− | {{#set: common name= | + | {{#set: common name=acyl-coenzyme_a_oxidase}} |
− | {{#set: | + | {{#set: common name=ORF}} |
+ | {{#set: common name=acyl-CoA_dehydrogenase}} | ||
+ | {{#set: ec number=EC-1.3.8.7}} | ||
+ | {{#set: gene associated=Tiso_gene_6475|Tiso_gene_14511|Tiso_gene_883|Tiso_gene_17967|Tiso_gene_16631|Tiso_gene_18566|Tiso_gene_5991|Tiso_gene_8272}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:43, 21 March 2018
Contents
Reaction RXN-14278
- direction:
- REVERSIBLE
- common name:
- hexanoyl-CoA dehydrogenase
- acyl-_dehydrogenase
- acyl-coenzyme_a_oxidase
- ORF
- acyl-CoA_dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 HEXANOYL-COA[c] + 1 PROTON[c] + 1 ETF-Oxidized[c] <=> 1 ETF-Reduced[c] + 1 CPD0-2121[c]
- With common name(s):
- 1 hexanoyl-CoA[c] + 1 H+[c] + 1 an oxidized electron-transfer flavoprotein[c] <=> 1 a reduced electron-transfer flavoprotein[c] + 1 trans-hex-2-enoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_6475
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14511
- Source: orthology-esiliculosus
- Gene: Tiso_gene_883
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_17967
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_16631
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_18566
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_5991
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_8272
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links