Difference between revisions of "N5-Formyl-THF-Glu-N"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] == * smiles: ** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N5-Formyl-THF-Glu-N N5-Formyl-THF-Glu-N] == * common name: ** an (6S)-N5-formyl-tetrahydrofolat...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N5-Formyl-THF-Glu-N N5-Formyl-THF-Glu-N] ==
−
* smiles:
+
−
** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))
+
−
* inchi key:
+
−
** InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M
+
 
* common name:
 
* common name:
−
** L-thyroxine phenolic β-D-glucuronide
+
** an (6S)-N5-formyl-tetrahydrofolate
−
* molecular weight:
+
−
** 951.992   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-thyroxine phenolic glucuronide
+
** a folinic acid
−
** thyroxine glucuronide
+
−
** beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)-
+
−
** T4G
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10606]]
+
* [[RXN-6321]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-6341]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an (6S)-N5-formyl-tetrahydrofolate}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237176 44237176]
+
{{#set: common name=a folinic acid}}
−
{{#set: smiles=C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))}}
+
{{#set: produced by=RXN-6321}}
−
{{#set: inchi key=InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M}}
+
{{#set: reversible reaction associated=RXN-6341}}
−
{{#set: common name=L-thyroxine phenolic β-D-glucuronide}}
+
−
{{#set: molecular weight=951.992    }}
+
−
{{#set: common name=L-thyroxine phenolic glucuronide|thyroxine glucuronide|beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)-|T4G}}
+
−
{{#set: produced by=RXN-10606}}
+

Latest revision as of 19:50, 21 March 2018

Metabolite N5-Formyl-THF-Glu-N

  • common name:
    • an (6S)-N5-formyl-tetrahydrofolate
  • Synonym(s):
    • a folinic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N5-Formyl-THF-Glu-N&oldid=44049"