Difference between revisions of "Tiso gene 5379"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)[O-] * inchi key:...")
(Created page with "Category:Gene == Gene Tiso_gene_5379 == * right end position: ** 13557 * transcription direction: ** POSITIVE * left end position: ** 10558 * centisome position: ** 77.878...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] ==
+
== Gene Tiso_gene_5379 ==
−
* smiles:
+
* right end position:
−
** C(O)CCCCCCCC=CCCCCCCCC(=O)[O-]
+
** 13557
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LQUHZVLTTWMBTO-UPHRSURJSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 18-hydroxyoleate
+
** 10558
−
* molecular weight:
+
* centisome position:
−
** 297.457    
+
** 77.878586    
 
* Synonym(s):
 
* Synonym(s):
−
** 18-hydroxyoctadec-9-enoic acid
 
−
** 18-hydroxy-9Z-octadecenoate
 
−
** ω-hydroxy-9Z-octadecenoate
 
−
** omega-hydroxy oleate
 
−
** 18-hydroxy-(9Z)-oleate(1-)
 
−
** ω-hydroxy-(9Z)-octadecenoate(1-)
 
−
** ω-hydroxyoleate(1-)
 
−
** (Z)-18-hydroxyoctadec-9-enoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16402]]
+
* Reaction: [[6.1.1.24-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[GLURS-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[TRNA-CHARGING-PWY]]
 +
* [[PWY-5188]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=13557}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289578 86289578]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=10558}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78424 78424]
+
{{#set: centisome position=77.878586   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=6.1.1.24-RXN|GLURS-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C19616 C19616]
+
{{#set: pathway associated=TRNA-CHARGING-PWY|PWY-5188}}
−
{{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=LQUHZVLTTWMBTO-UPHRSURJSA-M}}
+
−
{{#set: common name=18-hydroxyoleate}}
+
−
{{#set: molecular weight=297.457   }}
+
−
{{#set: common name=18-hydroxyoctadec-9-enoic acid|18-hydroxy-9Z-octadecenoate|ω-hydroxy-9Z-octadecenoate|omega-hydroxy oleate|18-hydroxy-(9Z)-oleate(1-)|ω-hydroxy-(9Z)-octadecenoate(1-)|ω-hydroxyoleate(1-)|(Z)-18-hydroxyoctadec-9-enoic acid}}
+
−
{{#set: consumed by=RXN-16402}}
+

Latest revision as of 19:50, 21 March 2018

Gene Tiso_gene_5379

  • right end position:
    • 13557
  • transcription direction:
    • POSITIVE
  • left end position:
    • 10558
  • centisome position:
    • 77.878586
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5379&oldid=44140"