Difference between revisions of "Tiso gene 5379"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)[O-] * inchi key:...") |
(Created page with "Category:Gene == Gene Tiso_gene_5379 == * right end position: ** 13557 * transcription direction: ** POSITIVE * left end position: ** 10558 * centisome position: ** 77.878...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_5379 == |
− | * | + | * right end position: |
− | ** | + | ** 13557 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 10558 |
− | * | + | * centisome position: |
− | ** | + | ** 77.878586 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[6.1.1.24-RXN]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | == | + | * Reaction: [[GLURS-RXN]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[TRNA-CHARGING-PWY]] | ||
+ | * [[PWY-5188]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=13557}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=10558}} | |
− | + | {{#set: centisome position=77.878586 }} | |
− | + | {{#set: reaction associated=6.1.1.24-RXN|GLURS-RXN}} | |
− | + | {{#set: pathway associated=TRNA-CHARGING-PWY|PWY-5188}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:50, 21 March 2018
Gene Tiso_gene_5379
- right end position:
- 13557
- transcription direction:
- POSITIVE
- left end position:
- 10558
- centisome position:
- 77.878586
- Synonym(s):
Reactions associated
- Reaction: 6.1.1.24-RXN
- Source: orthology-esiliculosus
- Reaction: GLURS-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation