Difference between revisions of "CPD0-2108"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_13074 == * left end position: ** 2848 * transcription direction: ** POSITIVE * right end position: ** 4501 * centisome position: ** 43.4610...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2108 CPD0-2108] == * smiles: ** CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-]...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_13074 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2108 CPD0-2108] ==
* left end position:
+
* smiles:
** 2848
+
** CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
* transcription direction:
+
* common name:
** POSITIVE
+
** trans-oct-2-enoyl-CoA
* right end position:
+
* inchi key:
** 4501
+
** InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J
* centisome position:
+
* molecular weight:
** 43.46101    
+
** 887.685    
 
* Synonym(s):
 
* Synonym(s):
 +
** (2E)-octenoyl-CoA
 +
** trans-2-octenoyl-coenzyme A
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.4.21.4-RXN]]
+
* [[RXN-14276]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
* [[RXN-12669]]
* [[RXN-17832]]
+
* [[ACOA80or]]
** in-silico_annotation
+
== Reaction(s) of unknown directionality ==
***automated-name-match
+
* [[RXN-14229]]
== Pathways associated ==
+
* [[PWY-7797]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=2848}}
+
* LIGAND-CPD:
{{#set: transcription direction=POSITIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05276 C05276]
{{#set: right end position=4501}}
+
* HMDB : HMDB03949
{{#set: centisome position=43.46101   }}
+
* CHEBI:
{{#set: reaction associated=3.4.21.4-RXN|RXN-17832}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62242 62242]
{{#set: pathway associated=PWY-7797}}
+
* BIGG : oc2coa
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173358 46173358]
 +
{{#set: smiles=CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}}
 +
{{#set: common name=trans-oct-2-enoyl-CoA}}
 +
{{#set: inchi key=InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J}}
 +
{{#set: molecular weight=887.685   }}
 +
{{#set: common name=(2E)-octenoyl-CoA|trans-2-octenoyl-coenzyme A}}
 +
{{#set: consumed by=RXN-14276}}
 +
{{#set: produced by=RXN-12669|ACOA80or}}
 +
{{#set: reversible reaction associated=RXN-14229}}

Latest revision as of 19:51, 21 March 2018

Metabolite CPD0-2108

  • smiles:
    • CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
  • common name:
    • trans-oct-2-enoyl-CoA
  • inchi key:
    • InChIKey=CPSDNAXXKWVYIY-NTLMCJQISA-J
  • molecular weight:
    • 887.685
  • Synonym(s):
    • (2E)-octenoyl-CoA
    • trans-2-octenoyl-coenzyme A

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O" cannot be used as a page name in this wiki.