Difference between revisions of "RXN-17778"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-1-MONOPHOSPHATE D-MYO-INOSITOL-1-MONOPHOSPHATE] == * smiles: ** C1(O)(C(O)C(O)C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17778 RXN-17778] == * direction: ** LEFT-TO-RIGHT * common name: ** thiolase ** acetyl-_c-acety...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-1-MONOPHOSPHATE D-MYO-INOSITOL-1-MONOPHOSPHATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17778 RXN-17778] ==
−
* smiles:
+
* direction:
−
** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=INAPMGSXUVUWAF-UOTPTPDRSA-L
+
 
* common name:
 
* common name:
−
** 1D-myo-inositol 1-monophosphate
+
** thiolase
−
* molecular weight:
+
** acetyl-_c-acetyltransferase
−
** 258.121   
+
** 3-ketoacyl-_thiolase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.16 EC-2.3.1.16]
 
* Synonym(s):
 
* Synonym(s):
−
** 1D-myo-inositol (1)-monophosphate
 
−
** 1D-myo-Inositol 1-phosphate
 
−
** D-myo-inositol (1)-monophosphate
 
−
** Ins(1)P1
 
−
** 1-D-myo-inositol-1-p
 
−
** Ins(1)P
 
−
** 1D-myo-inositol 1-phosphate
 
−
** Ins1P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-5408]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CO-A]][c] '''+''' 1 [[CPD-19169]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[CPD-19144]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-16261]]
+
** 1 coenzyme A[c] '''+''' 1 3-oxo-(9Z)-octadecenoyl-CoA[c] '''=>''' 1 acetyl-CoA[c] '''+''' 1 (7Z)-hexadecenoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_17451]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_15327]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10116]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_3856]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_3855]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* METABOLIGHTS : MTBLC58433
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=thiolase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288642 5288642]
+
{{#set: common name=acetyl-_c-acetyltransferase}}
−
* KNAPSACK : C00007483
+
{{#set: common name=3-ketoacyl-_thiolase}}
−
* HMDB : HMDB02985
+
{{#set: ec number=EC-2.3.1.16}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_17451|Tiso_gene_15327|Tiso_gene_10116|Tiso_gene_3856|Tiso_gene_3855}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01177 C01177]
+
{{#set: in pathway=}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.16744063.html 16744063]
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58433 58433]
+
−
* BIGG : mi1p__D
+
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-UOTPTPDRSA-L}}
+
−
{{#set: common name=1D-myo-inositol 1-monophosphate}}
+
−
{{#set: molecular weight=258.121    }}
+
−
{{#set: common name=1D-myo-inositol (1)-monophosphate|1D-myo-Inositol 1-phosphate|D-myo-inositol (1)-monophosphate|Ins(1)P1|1-D-myo-inositol-1-p|Ins(1)P|1D-myo-inositol 1-phosphate|Ins1P}}
+
−
{{#set: consumed by=RXN0-5408}}
+
−
{{#set: consumed or produced by=RXN-16261}}
+

Latest revision as of 19:53, 21 March 2018

Reaction RXN-17778

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • thiolase
    • acetyl-_c-acetyltransferase
    • 3-ketoacyl-_thiolase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 coenzyme A[c] + 1 3-oxo-(9Z)-octadecenoyl-CoA[c] => 1 acetyl-CoA[c] + 1 (7Z)-hexadecenoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-17778&oldid=44411"