Difference between revisions of "Tiso gene 6882"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] == * smiles: ** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH...")
(Created page with "Category:Gene == Gene Tiso_gene_6882 == * Synonym(s): == Reactions associated == * Reaction: GCVT-RXN ** Source: orthology-esiliculosus == Pathways associated ==...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] ==
+
== Gene Tiso_gene_6882 ==
* smiles:
+
** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))
+
* inchi key:
+
** InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M
+
* common name:
+
** (25R)-3α,7α-dihydroxy-5-β-cholestanate
+
* molecular weight:
+
** 433.65   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-α,7-α-dihydroxy-5-β-cholestanoate
 
** 3-α,7-α-dihydroxy-5-β-cholestanate
 
** (25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GCVT-RXN]]
* [[RXN-9844]]
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[GLYCLEAV-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=GCVT-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266753 45266753]
+
{{#set: pathway associated=GLYCLEAV-PWY}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58750 58750]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04554 C04554]
+
{{#set: smiles=CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))}}
+
{{#set: inchi key=InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M}}
+
{{#set: common name=(25R)-3α,7α-dihydroxy-5-β-cholestanate}}
+
{{#set: molecular weight=433.65    }}
+
{{#set: common name=3-α,7-α-dihydroxy-5-β-cholestanoate|3-α,7-α-dihydroxy-5-β-cholestanate|(25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate}}
+
{{#set: produced by=RXN-9844}}
+

Latest revision as of 19:53, 21 March 2018

Gene Tiso_gene_6882

  • Synonym(s):

Reactions associated

Pathways associated

External links