Difference between revisions of "CPD-4702"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=12-BIS4-HYDROXY-3-METHOXYPHENYLETHYLE 12-BIS4-HYDROXY-3-METHOXYPHENYLETHYLE] == * smiles: ** CO...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34)))) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** 4, | + | ** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol |
+ | * inchi key: | ||
+ | ** InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 427.646 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN66-318]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659076 90659076] |
− | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))}} | |
− | + | {{#set: common name=4α-carboxy-5α-cholesta-8,24-dien-3β-ol}} | |
− | + | {{#set: inchi key=InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M}} | |
− | + | {{#set: molecular weight=427.646 }} | |
− | + | {{#set: consumed by=RXN66-318}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: smiles | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: molecular weight= | + | |
− | + | ||
− | {{#set: consumed by= | + |
Latest revision as of 20:54, 21 March 2018
Contents
Metabolite CPD-4702
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))
- common name:
- 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
- inchi key:
- InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M
- molecular weight:
- 427.646
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.