Difference between revisions of "Tiso gene 14435"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] == * smiles: ** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O) * inchi key:...")
 
(Created page with "Category:Gene == Gene Tiso_gene_14435 == * right end position: ** 4621 * transcription direction: ** POSITIVE * left end position: ** 3530 * centisome position: ** 44.8823...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] ==
+
== Gene Tiso_gene_14435 ==
−
* smiles:
+
* right end position:
−
** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O)
+
** 4621
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (S)-equol
+
** 3530
−
* molecular weight:
+
* centisome position:
−
** 242.274    
+
** 44.88239    
 
* Synonym(s):
 
* Synonym(s):
−
** 4',7-isoflavandiol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[5-NUCLEOTID-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-15589]]
+
*** Assignment: ec-number
 +
* Reaction: [[AMP-DEPHOSPHORYLATION-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14025]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14026]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14227]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-5841]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-7607]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-7609]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[XMPXAN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-5381]]
 +
* [[PWY-6607]]
 +
* [[PWY-7185]]
 +
* [[PWY-7821]]
 +
* [[SALVADEHYPOX-PWY]]
 +
* [[PWY-6596]]
 +
* [[NAD-BIOSYNTHESIS-II]]
 +
* [[PWY-6606]]
 +
* [[PWY-6608]]
 +
* [[PWY-5695]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: right end position=4621}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C14131 C14131]
+
{{#set: transcription direction=POSITIVE}}
−
* Wikipedia : Equol
+
{{#set: left end position=3530}}
−
* HMDB : HMDB02209
+
{{#set: centisome position=44.88239   }}
−
* CHEBI:
+
{{#set: reaction associated=5-NUCLEOTID-RXN|AMP-DEPHOSPHORYLATION-RXN|RXN-14025|RXN-14026|RXN-14227|RXN-5841|RXN-7607|RXN-7609|XMPXAN-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34741 34741]
+
{{#set: pathway associated=PWY-5381|PWY-6607|PWY-7185|PWY-7821|SALVADEHYPOX-PWY|PWY-6596|NAD-BIOSYNTHESIS-II|PWY-6606|PWY-6608|PWY-5695}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91469 91469]
+
−
{{#set: smiles=C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O)}}
+
−
{{#set: inchi key=InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N}}
+
−
{{#set: common name=(S)-equol}}
+
−
{{#set: molecular weight=242.274   }}
+
−
{{#set: common name=4',7-isoflavandiol}}
+
−
{{#set: consumed or produced by=RXN-15589}}
+

Latest revision as of 19:18, 21 March 2018

Gene Tiso_gene_14435

  • right end position:
    • 4621
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3530
  • centisome position:
    • 44.88239
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14435&oldid=40765"