Difference between revisions of "ALDH im4ac"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE GALACTOSE] == * smiles: ** C(O)C1(OC(O)C(O)C(O)C(O)1) * inchi key: ** InChIKey=WQZGKK...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDH_im4ac ALDH_im4ac] == * direction: ** LEFT-TO-RIGHT * common name: ** aldehyde dehydrogenase (N...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDH_im4ac ALDH_im4ac] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** aldehyde dehydrogenase (NAD+), Imidazole-4-acetate forming |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1.0 [[WATER]][c] '''+''' 1.0 [[NAD]][c] '''+''' 1.0 [[IMIDAZOLE_ACETALDEHYDE]][c] '''=>''' 1.0 [[4-IMIDAZOLEACETATE]][c] '''+''' 2.0 [[PROTON]][c] '''+''' 1.0 [[NADH]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1.0 H2O[c] '''+''' 1.0 NAD+[c] '''+''' 1.0 imidazole acetaldehyde[c] '''=>''' 1.0 4-imidazoleacetate[c] '''+''' 2.0 H+[c] '''+''' 1.0 NADH[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_3513]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=aldehyde dehydrogenase (NAD+), Imidazole-4-acetate forming}} | |
| − | + | {{#set: gene associated=Tiso_gene_3513}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:57, 21 March 2018
Contents
Reaction ALDH_im4ac
- direction:
- LEFT-TO-RIGHT
- common name:
- aldehyde dehydrogenase (NAD+), Imidazole-4-acetate forming
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 WATER[c] + 1.0 NAD[c] + 1.0 IMIDAZOLE_ACETALDEHYDE[c] => 1.0 4-IMIDAZOLEACETATE[c] + 2.0 PROTON[c] + 1.0 NADH[c]
- With common name(s):
- 1.0 H2O[c] + 1.0 NAD+[c] + 1.0 imidazole acetaldehyde[c] => 1.0 4-imidazoleacetate[c] + 2.0 H+[c] + 1.0 NADH[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_3513
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
