Difference between revisions of "CPD-8291"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-4-aminobutylidene-enzyme-lysine N-4-aminobutylidene-enzyme-lysine] == * common name: ** a [de...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+]...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] == |
| + | * smiles: | ||
| + | ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O | ||
* common name: | * common name: | ||
| − | ** | + | ** 1-18:1-2-18:1-phosphatidylethanolamine |
| + | * inchi key: | ||
| + | ** InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N | ||
| + | * molecular weight: | ||
| + | ** 744.043 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** phosphatidylethanolamine (1-18:1-2-18:1) |
| + | ** 18:1-18:1-PE | ||
| + | ** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15067]] |
| + | * [[PE1819Z1819Zt]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PE1819Z1819Zt]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-15036]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44251425 44251425] |
| − | {{#set: consumed by=RXN- | + | * CHEBI: |
| − | {{#set: produced by=RXN- | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74986 74986] |
| + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O}} | ||
| + | {{#set: common name=1-18:1-2-18:1-phosphatidylethanolamine}} | ||
| + | {{#set: inchi key=InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N}} | ||
| + | {{#set: molecular weight=744.043 }} | ||
| + | {{#set: common name=phosphatidylethanolamine (1-18:1-2-18:1)|18:1-18:1-PE|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}} | ||
| + | {{#set: consumed by=RXN-15067|PE1819Z1819Zt}} | ||
| + | {{#set: produced by=PE1819Z1819Zt}} | ||
| + | {{#set: reversible reaction associated=RXN-15036}} | ||
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite CPD-8291
- smiles:
- CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O
- common name:
- 1-18:1-2-18:1-phosphatidylethanolamine
- inchi key:
- InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N
- molecular weight:
- 744.043
- Synonym(s):
- phosphatidylethanolamine (1-18:1-2-18:1)
- 18:1-18:1-PE
- 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O" cannot be used as a page name in this wiki.
