Difference between revisions of "Odd-Straight-Chain-234-Sat-FALD"

Latest revision as of 20:00, 21 March 2018

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Straight-Chain-234-Sat-FALD Odd-Straight-Chain-234-Sat-FALD] ==
-* smiles:
-** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
-* inchi key:
-** InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
 * common name:
-** tetrahydrogeranylgeranyl diphosphate
+** an odd numbered straight chain 2,3,4-saturated fatty aldehyde
-* molecular weight:
-** 451.456
 * Synonym(s):
-** tetrahydroGGPP
-** tetrahydrogeranylgeranyl pyrophosphate
-** tetrahydrogeranylgeranyl-PP
 == Reaction(s) known to consume the compound ==
+* [[RXN66-476]]
 == Reaction(s) known to produce the compound ==
 == Reaction(s) of unknown directionality ==
-* [[RXN-7659]]
-* [[RXN-7660]]
 == External links  ==
-* PUBCHEM:
+{{#set: common name=an odd numbered straight chain 2,3,4-saturated fatty aldehyde}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657275 90657275]
+{{#set: consumed by=RXN66-476}}
-{{#set: smiles=CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
-{{#set: inchi key=InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K}}
-{{#set: common name=tetrahydrogeranylgeranyl diphosphate}}
-{{#set: molecular weight=451.456    }}
-{{#set: common name=tetrahydroGGPP|tetrahydrogeranylgeranyl pyrophosphate|tetrahydrogeranylgeranyl-PP}}
-{{#set: consumed or produced by=RXN-7659|RXN-7660}}