Difference between revisions of "Odd-Straight-Chain-234-Sat-FALD"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Straight-Chain-234-Sat-FALD Odd-Straight-Chain-234-Sat-FALD] == * common name: ** an odd nu...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Straight-Chain-234-Sat-FALD Odd-Straight-Chain-234-Sat-FALD] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an odd numbered straight chain 2,3,4-saturated fatty aldehyde |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN66-476]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=an odd numbered straight chain 2,3,4-saturated fatty aldehyde}} | |
− | + | {{#set: consumed by=RXN66-476}} | |
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: consumed | + |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite Odd-Straight-Chain-234-Sat-FALD
- common name:
- an odd numbered straight chain 2,3,4-saturated fatty aldehyde
- Synonym(s):