Difference between revisions of "Tiso gene 4740"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)...")
(Created page with "Category:Gene == Gene Tiso_gene_4740 == * right end position: ** 14285 * transcription direction: ** POSITIVE * left end position: ** 7164 * centisome position: ** 49.8330...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] ==
+
== Gene Tiso_gene_4740 ==
−
* smiles:
+
* right end position:
−
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
+
** 14285
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K
+
** POSITIVE
−
* common name:
+
* left end position:
−
** dIDP
+
** 7164
−
* molecular weight:
+
* centisome position:
−
** 409.165    
+
** 49.833057    
 
* Synonym(s):
 
* Synonym(s):
−
** deoxyinosine diphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-14228]]
+
*** Assignment: automated-name-match
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: right end position=14285}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01344 C01344]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=7164}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62286 62286]
+
{{#set: centisome position=49.833057   }}
−
* BIGG : didp
+
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173552 46173552]
+
−
* HMDB : HMDB03536
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K}}
+
−
{{#set: common name=dIDP}}
+
−
{{#set: molecular weight=409.165   }}
+
−
{{#set: common name=deoxyinosine diphosphate}}
+
−
{{#set: consumed or produced by=RXN-14228}}
+

Latest revision as of 20:02, 21 March 2018

Gene Tiso_gene_4740

  • right end position:
    • 14285
  • transcription direction:
    • POSITIVE
  • left end position:
    • 7164
  • centisome position:
    • 49.833057
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4740&oldid=45353"