Difference between revisions of "Tiso gene 14583"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3...")
(Created page with "Category:Gene == Gene Tiso_gene_14583 == * right end position: ** 4916 * transcription direction: ** POSITIVE * left end position: ** 3517 * centisome position: ** 63.3009...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] ==
+
== Gene Tiso_gene_14583 ==
−
* smiles:
+
* right end position:
−
** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
+
** 4916
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 8-oxo-dGTP
+
** 3517
−
* molecular weight:
+
* centisome position:
−
** 519.151    
+
** 63.300938    
 
* Synonym(s):
 
* Synonym(s):
−
** 8-oxo-7,8-dihydro-2'-dGTP
 
−
** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
* [[RXN-11410]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
−
* [[RXN-14205]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4916}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237341 44237341]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=3517}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77896 77896]
+
{{#set: centisome position=63.300938   }}
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: inchi key=InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J}}
+
−
{{#set: common name=8-oxo-dGTP}}
+
−
{{#set: molecular weight=519.151   }}
+
−
{{#set: common name=8-oxo-7,8-dihydro-2'-dGTP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate}}
+
−
{{#set: produced by=RXN-11410}}
+
−
{{#set: consumed or produced by=RXN-14205}}
+

Latest revision as of 20:03, 21 March 2018

Gene Tiso_gene_14583

  • right end position:
    • 4916
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3517
  • centisome position:
    • 63.300938
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14583&oldid=45565"