Difference between revisions of "Tiso gene 16166"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14300 CPD-14300] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
(Created page with "Category:Gene == Gene Tiso_gene_16166 == * right end position: ** 1756 * transcription direction: ** POSITIVE * left end position: ** 700 * centisome position: ** 15.40493...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14300 CPD-14300] ==
+
== Gene Tiso_gene_16166 ==
−
* smiles:
+
* right end position:
−
** CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1756
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ASKKPQKSCFYPPP-FVLDFCIYSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 3-oxo-(11Z)-eicos-11-enoyl-CoA
+
** 700
−
* molecular weight:
+
* centisome position:
−
** 1069.99    
+
** 15.404930    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14484]]
+
* Reaction: [[RXN-15556]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-13322]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=1756}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581100 71581100]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=700}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74011 74011]
+
{{#set: centisome position=15.404930   }}
−
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
{{#set: inchi key=InChIKey=ASKKPQKSCFYPPP-FVLDFCIYSA-J}}
+
{{#set: pathway associated=PWY-7511}}
−
{{#set: common name=3-oxo-(11Z)-eicos-11-enoyl-CoA}}
+
−
{{#set: molecular weight=1069.99   }}
+
−
{{#set: consumed by=RXN-14484}}
+
−
{{#set: produced by=RXN-13322}}
+

Latest revision as of 20:04, 21 March 2018

Gene Tiso_gene_16166

  • right end position:
    • 1756
  • transcription direction:
    • POSITIVE
  • left end position:
    • 700
  • centisome position:
    • 15.404930
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16166&oldid=45694"