Difference between revisions of "Tiso gene 19802"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] == * smiles: ** C(C(C(C([O-])=O)=O)O...")
(Created page with "Category:Gene == Gene Tiso_gene_19802 == * Synonym(s): == Reactions associated == * Reaction: TRANS-RXN-233 ** Source: orthology-creinhardtii * Reaction: TRANS-...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3OH-4P-OH-ALPHA-KETOBUTYRATE 3OH-4P-OH-ALPHA-KETOBUTYRATE] ==
+
== Gene Tiso_gene_19802 ==
−
* smiles:
+
−
** C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]
+
−
* inchi key:
+
−
** InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K
+
−
* common name:
+
−
** (3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate
+
−
* molecular weight:
+
−
** 211.045   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-hydroxy-4-phospho-hydroxy-α-ketobutyrate
 
−
** 2-oxo-3-hydroxy-4-phosphobutanoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[TRANS-RXN-233]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-creinhardtii]]
−
* [[PSERTRANSAMPYR-RXN]]
+
* Reaction: [[TRANS-RXN-76]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[TRANS-RXN-77]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: reaction associated=TRANS-RXN-233|TRANS-RXN-76|TRANS-RXN-77}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06054 C06054]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58538 58538]
+
−
* BIGG : ohpb
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266680 45266680]
+
−
* HMDB : HMDB06801
+
−
{{#set: smiles=C(C(C(C([O-])=O)=O)O)OP([O-])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=MZJFVXDTNBHTKZ-UWTATZPHSA-K}}
+
−
{{#set: common name=(3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate}}
+
−
{{#set: molecular weight=211.045    }}
+
−
{{#set: common name=3-hydroxy-4-phospho-hydroxy-α-ketobutyrate|2-oxo-3-hydroxy-4-phosphobutanoate}}
+
−
{{#set: consumed or produced by=PSERTRANSAMPYR-RXN}}
+

Latest revision as of 20:04, 21 March 2018

Gene Tiso_gene_19802

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19802&oldid=45744"