Difference between revisions of "CANAVANINOSUCCINATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-hydroxyprolines Protein-hydroxyprolines] == * common name: ** a [protein]-trans-4-hydro...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINOSUCCINATE CANAVANINOSUCCINATE] == * smiles: ** C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINOSUCCINATE CANAVANINOSUCCINATE] == |
+ | * smiles: | ||
+ | ** C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O | ||
* common name: | * common name: | ||
− | ** | + | ** canavaninosuccinate |
+ | * inchi key: | ||
+ | ** InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M | ||
+ | * molecular weight: | ||
+ | ** 291.24 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-22]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-10]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820246 91820246] |
− | {{#set: consumed | + | * HMDB : HMDB12197 |
+ | {{#set: smiles=C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O}} | ||
+ | {{#set: common name=canavaninosuccinate}} | ||
+ | {{#set: inchi key=InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M}} | ||
+ | {{#set: molecular weight=291.24 }} | ||
+ | {{#set: consumed by=RXN-22}} | ||
+ | {{#set: produced by=RXN-10}} |
Latest revision as of 20:06, 21 March 2018
Contents
Metabolite CANAVANINOSUCCINATE
- smiles:
- C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O
- common name:
- canavaninosuccinate
- inchi key:
- InChIKey=SGYMGUGIGTWWLU-ROLXFIACSA-M
- molecular weight:
- 291.24
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12197
"C(ONC(=[N+])NC(CC(=O)[O-])C(=O)[O-])CC([N+])C([O-])=O" cannot be used as a page name in this wiki.