Difference between revisions of "Tiso gene 9504"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12259 CPD-12259] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CC...")
(Created page with "Category:Gene == Gene Tiso_gene_9504 == * right end position: ** 3786 * transcription direction: ** NEGATIVE * left end position: ** 1799 * centisome position: ** 19.3816...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12259 CPD-12259] ==
+
== Gene Tiso_gene_9504 ==
−
* smiles:
+
* right end position:
−
** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP([O-])(=O)OP([O-])(=O)OC4(OC(CO)C(OC3(OC(CO)C(OC2(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)2))C(O)C(NC(=O)C)3))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)4))C)C)C)C)C)C
+
** 3786
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YDLQGHNIONNLSM-SHGYSNKBSA-L
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** a peptidoglycan dimer (S. aureus)
+
** 1799
−
* molecular weight:
+
* centisome position:
−
** 3391.761    
+
** 19.3816    
 
* Synonym(s):
 
* Synonym(s):
−
** [N-acetylglucosamine-N-acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-(Gly5)-D-alanyl-D-alanine]2 diphospho-undecaprenyl
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11065]]
+
* Reaction: [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-1101]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-1106]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-1124]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-17678]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-600]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-7784]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-9723]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-9724]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-9725]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6027]]
 +
* [[PWY-361]]
 +
* [[PWY-5152]]
 +
* [[PWY1F-823]]
 +
* [[PWY-6035]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3786}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659087 90659087]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP([O-])(=O)OP([O-])(=O)OC4(OC(CO)C(OC3(OC(CO)C(OC2(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)2))C(O)C(NC(=O)C)3))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)4))C)C)C)C)C)C}}
+
{{#set: left end position=1799}}
−
{{#set: inchi key=InChIKey=YDLQGHNIONNLSM-SHGYSNKBSA-L}}
+
{{#set: centisome position=19.3816   }}
−
{{#set: common name=a peptidoglycan dimer (S. aureus)}}
+
{{#set: reaction associated=DIHYDROKAEMPFEROL-4-REDUCTASE-RXN|RXN-1101|RXN-1106|RXN-1124|RXN-17678|RXN-600|RXN-7784|RXN-9723|RXN-9724|RXN-9725}}
−
{{#set: molecular weight=3391.761   }}
+
{{#set: pathway associated=PWY-6027|PWY-361|PWY-5152|PWY1F-823|PWY-6035}}
−
{{#set: common name=[N-acetylglucosamine-N-acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-(Gly5)-D-alanyl-D-alanine]2 diphospho-undecaprenyl}}
+
−
{{#set: consumed by=RXN-11065}}
+

Latest revision as of 20:07, 21 March 2018

Gene Tiso_gene_9504

  • right end position:
    • 3786
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 1799
  • centisome position:
    • 19.3816
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9504&oldid=46116"