Difference between revisions of "CPD-6701"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alpha-hydroxyphytoceramides Alpha-hydroxyphytoceramides] == * common name: ** a (2'R)-2'-hydrox...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) * common name: *...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == |
+ | * smiles: | ||
+ | ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) | ||
* common name: | * common name: | ||
− | ** | + | ** 1D-myo-inositol 5-monophosphate |
+ | * inchi key: | ||
+ | ** InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L | ||
+ | * molecular weight: | ||
+ | ** 258.121 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** D-myo-inositol 5-monophosphate |
+ | ** Ins(5)P1 | ||
+ | ** 1D-myo-inositol 5-phosphate | ||
+ | ** Ins(5)P | ||
+ | ** Ins5P | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10953]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}} |
− | {{#set: common name= | + | {{#set: common name=1D-myo-inositol 5-monophosphate}} |
− | {{#set: consumed | + | {{#set: inchi key=InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L}} |
+ | {{#set: molecular weight=258.121 }} | ||
+ | {{#set: common name=D-myo-inositol 5-monophosphate|Ins(5)P1|1D-myo-inositol 5-phosphate|Ins(5)P|Ins5P}} | ||
+ | {{#set: consumed by=RXN-10953}} |
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite CPD-6701
- smiles:
- C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
- common name:
- 1D-myo-inositol 5-monophosphate
- inchi key:
- InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L
- molecular weight:
- 258.121
- Synonym(s):
- D-myo-inositol 5-monophosphate
- Ins(5)P1
- 1D-myo-inositol 5-phosphate
- Ins(5)P
- Ins5P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)" cannot be used as a page name in this wiki.