Difference between revisions of "GLUCONATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13575 CPD-13575] == * smiles: ** CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1) * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * common name: ** D-gluconat...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** D-gluconate |
+ | * inchi key: | ||
+ | ** InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 195.149 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** D-gluconic acid |
− | ** | + | ** dextronic acid |
− | ** | + | ** maltonic acid |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[GLUCONOLACT-RXN]] | ||
+ | * [[RXN-17754]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CAS : 526-95-4 | ||
+ | * BIGG : glcn | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419706 6419706] |
+ | * HMDB : HMDB00625 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00257 C00257] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4925340.html 4925340] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18391 18391] |
− | {{#set: smiles= | + | * METABOLIGHTS : MTBLC18391 |
− | {{#set: | + | {{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}} |
− | {{#set: | + | {{#set: common name=D-gluconate}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-M}} |
− | {{#set: common name= | + | {{#set: molecular weight=195.149 }} |
− | {{#set: | + | {{#set: common name=D-gluconic acid|dextronic acid|maltonic acid}} |
+ | {{#set: produced by=GLUCONOLACT-RXN|RXN-17754}} |
Latest revision as of 20:10, 21 March 2018
Contents
Metabolite GLUCONATE
- smiles:
- C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
- common name:
- D-gluconate
- inchi key:
- InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-M
- molecular weight:
- 195.149
- Synonym(s):
- D-gluconic acid
- dextronic acid
- maltonic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 526-95-4
- BIGG : glcn
- PUBCHEM:
- HMDB : HMDB00625
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC18391
"C(O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.