Difference between revisions of "FACOAL18111Z"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FACOAL18111Z FACOAL18111Z] == * direction: ** LEFT-TO-RIGHT * common name: ** long-chain acyl-CoA s...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FACOAL18111Z FACOAL18111Z] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L
+
 
* common name:
 
* common name:
−
** tetraiodothyroacetate ether glucuronide
+
** long-chain acyl-CoA synthetase (18:1(11Z))
−
* molecular weight:
+
−
** 921.943   
+
 
* Synonym(s):
 
* Synonym(s):
−
** tetraiodothyroacetic acid ether glucuronide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-10616]]
+
** 1.0 [[CO-A]][c] '''+''' 1.0 [[ATP]][c] '''+''' 1.0 [[OLEATE-CPD]][c] '''=>''' 1.0 [[CPD-18346]][c] '''+''' 1.0 [[PPI]][c] '''+''' 1.0 [[AMP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 coenzyme A[c] '''+''' 1.0 ATP[c] '''+''' 1.0 oleate[c] '''=>''' 1.0 cis-vaccenoyl-CoA[c] '''+''' 1.0 diphosphate[c] '''+''' 1.0 AMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12275]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_9394]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659237 90659237]
+
{{#set: common name=long-chain acyl-CoA synthetase (18:1(11Z))}}
−
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))}}
+
{{#set: gene associated=Tiso_gene_12275|Tiso_gene_9394}}
−
{{#set: inchi key=InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L}}
+
{{#set: in pathway=}}
−
{{#set: common name=tetraiodothyroacetate ether glucuronide}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=921.943    }}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=tetraiodothyroacetic acid ether glucuronide}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: produced by=RXN-10616}}
+

Latest revision as of 20:10, 21 March 2018

Reaction FACOAL18111Z

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • long-chain acyl-CoA synthetase (18:1(11Z))
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 coenzyme A[c] + 1.0 ATP[c] + 1.0 oleate[c] => 1.0 cis-vaccenoyl-CoA[c] + 1.0 diphosphate[c] + 1.0 AMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=FACOAL18111Z&oldid=46533"