Difference between revisions of "RXN-9896"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] == * smiles: ** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1) * inchi key: ** InChIKey=AAW...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9896 RXN-9896] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9896 RXN-9896] ==
* smiles:
+
* direction:
** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M
+
* common name:
+
** L-quinate
+
* molecular weight:
+
** 191.16   
+
 
* Synonym(s):
 
* Synonym(s):
** (-)-quinic acid
 
** (-)-quinate
 
** (1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[QUINATE-5-DEHYDROGENASE-RXN]]
+
* With identifiers:
* [[RXN-7967]]
+
** 1 [[3-HYDROXY-N6N6N6-TRIMETHYL-L-LYSINE]][c] '''=>''' 1 [[4-TRIMETHYLAMMONIOBUTANAL]][c] '''+''' 1 [[GLY]][c]
== Reaction(s) known to produce the compound ==
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 3-hydroxy-N6,N6,N6-trimethyl-L-lysine[c] '''=>''' 1 4-trimethylammoniobutanal[c] '''+''' 1 glycine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13940]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6100]], L-carnitine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6100 PWY-6100]
 +
** '''1''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 77-95-2
+
* LIGAND-RXN:
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R03284 R03284]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1560034 1560034]
+
{{#set: direction=LEFT-TO-RIGHT}}
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_13940}}
** [http://www.chemspider.com/Chemical-Structure.1272058.html 1272058]
+
{{#set: in pathway=PWY-6100}}
* CHEBI:
+
{{#set: reconstruction category=orthology}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29751 29751]
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.genome.jp/dbget-bin/www_bget?C00296 C00296]
+
{{#set: smiles=C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)}}
+
{{#set: inchi key=InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M}}
+
{{#set: common name=L-quinate}}
+
{{#set: molecular weight=191.16    }}
+
{{#set: common name=(-)-quinic acid|(-)-quinate|(1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate}}
+
{{#set: consumed by=QUINATE-5-DEHYDROGENASE-RXN|RXN-7967}}
+

Latest revision as of 20:14, 21 March 2018

Reaction RXN-9896

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6100, L-carnitine biosynthesis: PWY-6100
    • 1 reactions found over 4 reactions in the full pathway

Reconstruction information

External links