Difference between revisions of "Beta-hydroxydecanoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TAGATURONATE D-TAGATURONATE] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** I...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-hydroxydecanoyl-ACPs Beta-hydroxydecanoyl-ACPs] == * common name: ** a (3R)-3-hydroxydecan...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-hydroxydecanoyl-ACPs Beta-hydroxydecanoyl-ACPs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a (3R)-3-hydroxydecanoyl-[acp] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** an (R)-3-hydroxydecanoyl-[acyl-carrier protein] |
| − | ** | + | ** a β-hydroxydecanoyl-[acp] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-9655]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9528]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a (3R)-3-hydroxydecanoyl-[acp]}} | |
| − | + | {{#set: common name=an (R)-3-hydroxydecanoyl-[acyl-carrier protein]|a β-hydroxydecanoyl-[acp]}} | |
| − | + | {{#set: consumed by=RXN-9655}} | |
| − | + | {{#set: produced by=RXN-9528}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:20, 21 March 2018
Contents
Metabolite Beta-hydroxydecanoyl-ACPs
- common name:
- a (3R)-3-hydroxydecanoyl-[acp]
- Synonym(s):
- an (R)-3-hydroxydecanoyl-[acyl-carrier protein]
- a β-hydroxydecanoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a (3R)-3-hydroxydecanoyl-[acp" cannot be used as a page name in this wiki.
- "an (R)-3-hydroxydecanoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
- "a β-hydroxydecanoyl-[acp" cannot be used as a page name in this wiki.
