Difference between revisions of "Tiso gene 1404"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(...")
(Created page with "Category:Gene == Gene Tiso_gene_1404 == * right end position: ** 10758 * transcription direction: ** POSITIVE * left end position: ** 8802 * centisome position: ** 36.9195...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] ==
+
== Gene Tiso_gene_1404 ==
−
* smiles:
+
* right end position:
−
** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
** 10758
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 14-hydroxylanosterol
+
** 8802
−
* molecular weight:
+
* centisome position:
−
** 442.724    
+
** 36.91959    
 
* Synonym(s):
 
* Synonym(s):
−
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-304]]
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN66-303]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=10758}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298935 22298935]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
{{#set: left end position=8802}}
−
{{#set: inchi key=InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N}}
+
{{#set: centisome position=36.91959   }}
−
{{#set: common name=14-hydroxylanosterol}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: molecular weight=442.724   }}
+
−
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol}}
+
−
{{#set: consumed by=RXN66-304}}
+
−
{{#set: produced by=RXN66-303}}
+

Latest revision as of 20:16, 21 March 2018

Gene Tiso_gene_1404

  • right end position:
    • 10758
  • transcription direction:
    • POSITIVE
  • left end position:
    • 8802
  • centisome position:
    • 36.91959
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1404&oldid=47290"