Difference between revisions of "CPD-7090"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12541 RXN-12541] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7090 CPD-7090] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-]...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12541 RXN-12541] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7090 CPD-7090] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))
 +
* common name:
 +
** delphinidin
 +
* inchi key:
 +
** InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 301.232   
 
* Synonym(s):
 
* Synonym(s):
 +
** delfinidin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-9723]]
−
** 2 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[FE+2]][c] '''=>''' 2 [[SUPER-OXIDE]][c] '''+''' 2 [[FE+3]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-7785]]
−
** 2 oxygen[c] '''+''' 2 Fe2+[c] '''=>''' 2 superoxide[c] '''+''' 2 Fe3+[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-6854]], ethylene biosynthesis III (microbes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6854 PWY-6854]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: in pathway=PWY-6854}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203213 25203213]
−
{{#set: reconstruction category=annotation}}
+
* HMDB : HMDB03074
−
{{#set: reconstruction tool=pathwaytools}}
+
* CHEBI:
−
{{#set: reconstruction source=in-silico_annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28436 28436]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05908 C05908]
 +
{{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))}}
 +
{{#set: common name=delphinidin}}
 +
{{#set: inchi key=InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=301.232    }}
 +
{{#set: common name=delfinidin}}
 +
{{#set: consumed by=RXN-9723}}
 +
{{#set: produced by=RXN-7785}}

Latest revision as of 20:16, 21 March 2018

Metabolite CPD-7090

  • smiles:
    • C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))
  • common name:
    • delphinidin
  • inchi key:
    • InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M
  • molecular weight:
    • 301.232
  • Synonym(s):
    • delfinidin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-7090&oldid=47388"