Difference between revisions of "SACCHAROPINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13008 CPD-13008] == * smiles: ** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SACCHAROPINE SACCHAROPINE] == * smiles: ** C(CC[N+]C(CCC([O-])=O)C([O-])=O)CC([N+])C([O-])=O *...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SACCHAROPINE SACCHAROPINE] == |
* smiles: | * smiles: | ||
| − | ** C(C( | + | ** C(CC[N+]C(CCC([O-])=O)C([O-])=O)CC([N+])C([O-])=O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-saccharopine |
| + | * inchi key: | ||
| + | ** InChIKey=ZDGJAHTZVHVLOT-YUMQZZPRSA-M | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 275.281 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** saccharopine |
| + | ** N6-(L-1,3-dicarboxypropyl)-L-lysine | ||
| + | ** ε-N-(L-glutar-2-yl)-L-lysine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[1.5.1.7-RXN]] |
| + | * [[1.5.1.9-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[1.5.1.8-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00449 C00449] | ||
| + | * HMDB : HMDB00279 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57951 57951] | ||
| + | * METABOLIGHTS : MTBLC57951 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791954 49791954] |
| − | {{#set: smiles=C( | + | {{#set: smiles=C(CC[N+]C(CCC([O-])=O)C([O-])=O)CC([N+])C([O-])=O}} |
| − | {{#set: | + | {{#set: common name=L-saccharopine}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ZDGJAHTZVHVLOT-YUMQZZPRSA-M}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=275.281 }} |
| − | {{#set: common name= | + | {{#set: common name=saccharopine|N6-(L-1,3-dicarboxypropyl)-L-lysine|ε-N-(L-glutar-2-yl)-L-lysine}} |
| − | {{#set: consumed by=RXN- | + | {{#set: consumed by=1.5.1.7-RXN|1.5.1.9-RXN}} |
| + | {{#set: produced by=1.5.1.8-RXN}} | ||
Latest revision as of 20:17, 21 March 2018
Contents
Metabolite SACCHAROPINE
- smiles:
- C(CC[N+]C(CCC([O-])=O)C([O-])=O)CC([N+])C([O-])=O
- common name:
- L-saccharopine
- inchi key:
- InChIKey=ZDGJAHTZVHVLOT-YUMQZZPRSA-M
- molecular weight:
- 275.281
- Synonym(s):
- saccharopine
- N6-(L-1,3-dicarboxypropyl)-L-lysine
- ε-N-(L-glutar-2-yl)-L-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC[N+]C(CCC([O-])=O)C([O-])=O)CC([N+])C([O-])=O" cannot be used as a page name in this wiki.
