Difference between revisions of "RXN-12243"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYADENOSINE DEOXYADENOSINE] == * smiles: ** C(O)C1(OC(CC(O)1)N3(C=NC2(=C(N)N=CN=C23))) * inc...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12243 RXN-12243] == * direction: ** LEFT-TO-RIGHT * common name: ** 15-cis-phytoene desaturase...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12243 RXN-12243] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 15-cis-phytoene desaturase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** phytoene desaturase (ambiguous) |
− | ** | + | ** PDS |
+ | ** plant-type phytoene desaturase | ||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[CPD-12321]][c] '''+''' 1 [[PLASTOQUINONE]][c] '''=>''' 1 [[Plastoquinols]][c] '''+''' 1 [[CPD-13171]][c] | |
− | + | * With common name(s): | |
− | == | + | ** 1 15-cis-phytoene[c] '''+''' 1 a plastoquinone[c] '''=>''' 1 a plastoquinol[c] '''+''' 1 15,9'-di-cis-phytofluene[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | * [[PWY-6475]], trans-lycopene biosynthesis II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6475 PWY-6475] | ||
+ | ** '''8''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-reactions_pwy-6475_tiso_add]] | ||
+ | *** Comment: [[reaction added to complete pwy-6475]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30194 30194] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R09653 R09653] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=15-cis-phytoene desaturase}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=phytoene desaturase (ambiguous)|PDS|plant-type phytoene desaturase}} |
− | + | {{#set: in pathway=PWY-6475}} | |
− | + | {{#set: reconstruction category=manual}} | |
− | + | {{#set: reconstruction source=manual-reactions_pwy-6475_tiso_add}} | |
− | + | {{#set: reconstruction comment=reaction added to complete pwy-6475}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:18, 21 March 2018
Contents
Reaction RXN-12243
- direction:
- LEFT-TO-RIGHT
- common name:
- 15-cis-phytoene desaturase
- Synonym(s):
- phytoene desaturase (ambiguous)
- PDS
- plant-type phytoene desaturase
Reaction Formula
- With identifiers:
- 1 CPD-12321[c] + 1 PLASTOQUINONE[c] => 1 Plastoquinols[c] + 1 CPD-13171[c]
- With common name(s):
- 1 15-cis-phytoene[c] + 1 a plastoquinone[c] => 1 a plastoquinol[c] + 1 15,9'-di-cis-phytofluene[c]
Genes associated with this reaction
Pathways
- PWY-6475, trans-lycopene biosynthesis II (plants): PWY-6475
- 8 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: manual
- Source: manual-reactions_pwy-6475_tiso_add
- Comment: reaction added to complete pwy-6475
- Source: manual-reactions_pwy-6475_tiso_add
External links