Difference between revisions of "CPD-10825"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12581 RXN-12581] == * direction: ** LEFT-TO-RIGHT * common name: ** dehydrogenase_reductase_sdr...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10825 CPD-10825] == * smiles: ** CC1(=C(OC(C1)=O)CC([O-])=O) * common name: ** 4-methyl-3-o...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12581 RXN-12581] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10825 CPD-10825] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC1(=C(OC(C1)=O)CC([O-])=O)
 
* common name:
 
* common name:
** dehydrogenase_reductase_sdr_family_member_on_chromosome_x-like
+
** 4-methyl-3-oxoadipate-enol-lactone
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/1.1.1.105 EC-1.1.1.105]
+
** InChIKey=DAJDHKXIQYXYPH-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 155.13   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-10083]]
** 1 [[NAD]][c] '''+''' 1 [[CRPB-all-trans-Retinol]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CRPB-all-trans-Retinal]][c] '''+''' 1 [[NADH]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 NAD+[c] '''+''' 1 an all-trans retinol-[cellular-retinol-binding-protein][c] '''=>''' 1 H+[c] '''+''' 1 an all-trans retinal-[cellular-retinol-binding-protein][c] '''+''' 1 NADH[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_17086]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
== Pathways  ==
+
* [[PWY-6872]], retinoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6872 PWY-6872]
+
** '''1''' reactions found over '''4''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=dehydrogenase_reductase_sdr_family_member_on_chromosome_x-like}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123582 44123582]
{{#set: ec number=EC-1.1.1.105}}
+
{{#set: smiles=CC1(=C(OC(C1)=O)CC([O-])=O)}}
{{#set: gene associated=Tiso_gene_17086}}
+
{{#set: common name=4-methyl-3-oxoadipate-enol-lactone}}
{{#set: in pathway=PWY-6872}}
+
{{#set: inchi key=InChIKey=DAJDHKXIQYXYPH-UHFFFAOYSA-M}}
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=155.13    }}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: consumed by=RXN-10083}}
{{#set: reconstruction source=in-silico_annotation}}
+

Latest revision as of 20:19, 21 March 2018

Metabolite CPD-10825

  • smiles:
    • CC1(=C(OC(C1)=O)CC([O-])=O)
  • common name:
    • 4-methyl-3-oxoadipate-enol-lactone
  • inchi key:
    • InChIKey=DAJDHKXIQYXYPH-UHFFFAOYSA-M
  • molecular weight:
    • 155.13
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(=C(OC(C1)=O)CC([O-])=O)" cannot be used as a page name in this wiki.