Difference between revisions of "RXN-12037"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] == * smiles: ** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12037 RXN-12037] == * direction: ** LEFT-TO-RIGHT * common name: ** 3',5'-diiodothyronine 5'-de...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12037 RXN-12037] ==
* smiles:
+
* direction:
** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N
+
 
* common name:
 
* common name:
** pelargonidin-3,5-di-O-β-D-glucoside
+
** 3',5'-diiodothyronine 5'-deiodinase
* molecular weight:
+
** type_i_iodothyronine_deiodinase
** 594.525   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.21.99.4 EC-1.21.99.4]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-7828]]
+
** 1 [[Donor-H2]][c] '''+''' 1 [[CPD-13008]][c] '''=>''' 1 [[CPD-387]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-13010]][c] '''+''' 1 [[Acceptor]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a reduced electron acceptor[c] '''+''' 1 3',5'-diiodothyronine[c] '''=>''' 1 iodide[c] '''+''' 1 H+[c] '''+''' 1 3'-monoiodothyronine[c] '''+''' 1 an oxidized electron acceptor[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_20481]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6260]], thyroid hormone metabolism I (via deiodination): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6260 PWY-6260]
 +
** '''3''' reactions found over '''12''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167643 167643]
+
{{#set: common name=3',5'-diiodothyronine 5'-deiodinase}}
* CHEBI:
+
{{#set: common name=type_i_iodothyronine_deiodinase}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57503 57503]
+
{{#set: ec number=EC-1.21.99.4}}
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_20481}}
** [http://www.genome.jp/dbget-bin/www_bget?C08725 C08725]
+
{{#set: in pathway=PWY-6260}}
* HMDB : HMDB33681
+
{{#set: reconstruction category=annotation}}
{{#set: smiles=C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: inchi key=InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=pelargonidin-3,5-di-O-β-D-glucoside}}
+
{{#set: molecular weight=594.525    }}
+
{{#set: produced by=RXN-7828}}
+

Latest revision as of 20:19, 21 March 2018

Reaction RXN-12037

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3',5'-diiodothyronine 5'-deiodinase
    • type_i_iodothyronine_deiodinase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a reduced electron acceptor[c] + 1 3',5'-diiodothyronine[c] => 1 iodide[c] + 1 H+[c] + 1 3'-monoiodothyronine[c] + 1 an oxidized electron acceptor[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6260, thyroid hormone metabolism I (via deiodination): PWY-6260
    • 3 reactions found over 12 reactions in the full pathway

Reconstruction information

External links