Difference between revisions of "RXN-14187"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] == * smiles: ** CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14187 RXN-14187] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14187 RXN-14187] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J
+
 
* common name:
 
* common name:
−
** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA
+
** ORF
−
* molecular weight:
+
* ec number:
−
** 967.814   
+
** [http://enzyme.expasy.org/EC/3.6.1.6 EC-3.6.1.6]
 
* Synonym(s):
 
* Synonym(s):
−
** 2E, 5Z, 7E-tetradecatrienoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-14796]]
+
** 1 [[WATER]][c] '''+''' 1 [[DCDP]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[DCMP]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 dCDP[c] '''=>''' 1 phosphate[c] '''+''' 1 dCMP[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_20236]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_12899]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7210]], pyrimidine deoxyribonucleotides biosynthesis from CTP: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7210 PWY-7210]
 +
** '''8''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657959 90657959]
+
{{#set: common name=ORF}}
−
{{#set: smiles=CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: ec number=EC-3.6.1.6}}
−
{{#set: inchi key=InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J}}
+
{{#set: gene associated=Tiso_gene_20236|Tiso_gene_12899}}
−
{{#set: common name=2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA}}
+
{{#set: in pathway=PWY-7210}}
−
{{#set: molecular weight=967.814    }}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: common name=2E, 5Z, 7E-tetradecatrienoyl-CoA}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: produced by=RXN-14796}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:20, 21 March 2018

Reaction RXN-14187

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 dCDP[c] => 1 phosphate[c] + 1 dCMP[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7210, pyrimidine deoxyribonucleotides biosynthesis from CTP: PWY-7210
    • 8 reactions found over 8 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14187&oldid=47973"