Difference between revisions of "CPD-7004"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18908 == * left end position: ** 29 * transcription direction: ** NEGATIVE * right end position: ** 2205 * centisome position: ** 1.0642202...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] == |
− | * | + | * smiles: |
− | ** | + | ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) |
− | * | + | * common name: |
− | ** | + | ** dihydrogeranylgeranyl chlorophyll a |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 888.463 |
* Synonym(s): | * Synonym(s): | ||
+ | ** dihydrogeranylgeranyl-chl a | ||
+ | ** dihydroGG-chl a | ||
+ | ** dihydroGG-chlorophyll a | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-7665]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-7664]] |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926294 46926294] |
− | {{#set: | + | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} |
− | {{#set: | + | {{#set: common name=dihydrogeranylgeranyl chlorophyll a}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M}} |
+ | {{#set: molecular weight=888.463 }} | ||
+ | {{#set: common name=dihydrogeranylgeranyl-chl a|dihydroGG-chl a|dihydroGG-chlorophyll a}} | ||
+ | {{#set: consumed by=RXN-7665}} | ||
+ | {{#set: produced by=RXN-7664}} |
Latest revision as of 20:21, 21 March 2018
Contents
Metabolite CPD-7004
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
- common name:
- dihydrogeranylgeranyl chlorophyll a
- inchi key:
- InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M
- molecular weight:
- 888.463
- Synonym(s):
- dihydrogeranylgeranyl-chl a
- dihydroGG-chl a
- dihydroGG-chlorophyll a
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.