Difference between revisions of "Tiso gene 5022"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Tiso_gene_5022 == * right end position: ** 4811 * transcription direction: ** NEGATIVE * left end position: ** 718 * centisome position: ** 3.7029397...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_5022 == |
− | * | + | * right end position: |
− | ** | + | ** 4811 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 718 |
− | * | + | * centisome position: |
− | ** | + | ** 3.7029397 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4811}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=718}} | |
− | + | {{#set: centisome position=3.7029397 }} | |
− | {{#set: | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 21:22, 21 March 2018
Gene Tiso_gene_5022
- right end position:
- 4811
- transcription direction:
- NEGATIVE
- left end position:
- 718
- centisome position:
- 3.7029397
- Synonym(s):
Reactions associated
- Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation