Difference between revisions of "RXN-13680"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] == * smiles: ** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13680 RXN-13680] == * direction: ** REVERSIBLE * common name: ** aspartoacylase ** probable_asp...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13680 RXN-13680] ==
−
* smiles:
+
* direction:
−
** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M
+
 
* common name:
 
* common name:
−
** geranylgeranyl chlorophyll a
+
** aspartoacylase
−
* molecular weight:
+
** probable_aspartoacylase
−
** 886.447   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.5.1.15 EC-3.5.1.15]
 
* Synonym(s):
 
* Synonym(s):
−
** geranylgeranyl-chl a
 
−
** GG-chl a
 
−
** GG-chlorophyll a
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7664]]
+
* With identifiers:
−
* [[RXN-17428]]
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-420]][c] '''<=>''' 1 [[ACET]][c] '''+''' 1 [[L-ASPARTATE]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN-7663]]
+
** 1 H2O[c] '''+''' 1 N-acetyl-L-aspartate[c] '''<=>''' 1 acetate[c] '''+''' 1 L-aspartate[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_16773]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Tiso_gene_9219]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657538 90657538]
+
{{#set: common name=aspartoacylase}}
−
* CHEBI:
+
{{#set: common name=probable_aspartoacylase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64668 64668]
+
{{#set: ec number=EC-3.5.1.15}}
−
{{#set: smiles=C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))}}
+
{{#set: gene associated=Tiso_gene_16773|Tiso_gene_9219}}
−
{{#set: inchi key=InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M}}
+
{{#set: in pathway=}}
−
{{#set: common name=geranylgeranyl chlorophyll a}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=886.447    }}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: common name=geranylgeranyl-chl a|GG-chl a|GG-chlorophyll a}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: consumed by=RXN-7664|RXN-17428}}
+
−
{{#set: produced by=RXN-7663}}
+

Latest revision as of 20:22, 21 March 2018

Reaction RXN-13680

  • direction:
    • REVERSIBLE
  • common name:
    • aspartoacylase
    • probable_aspartoacylase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 N-acetyl-L-aspartate[c] <=> 1 acetate[c] + 1 L-aspartate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-13680&oldid=48271"