Difference between revisions of "BCor"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ALPHA-ACETYLORNITHINE N-ALPHA-ACETYLORNITHINE] == * smiles: ** CC(=O)NC(CCC[N+])C(=O)[O-] * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BCor BCor] == * direction: ** REVERSIBLE * common name: ** butanoyl-CoA:(acceptor) 2,3-oxidoreducta...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BCor BCor] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** butanoyl-CoA:(acceptor) 2,3-oxidoreductase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1.0 [[NAD]][c] '''+''' 1.0 [[BUTYRYL-COA]][c] '''<=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NADH]][c] '''+''' 1.0 [[CROTONYL-COA]][c] |
− | == | + | * With common name(s): |
− | == | + | ** 1.0 NAD+[c] '''+''' 1.0 butanoyl-CoA[c] '''<=>''' 1.0 H+[c] '''+''' 1.0 NADH[c] '''+''' 1.0 crotonyl-CoA[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_10643]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_16113]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=butanoyl-CoA:(acceptor) 2,3-oxidoreductase}} | |
− | + | {{#set: gene associated=Tiso_gene_10643|Tiso_gene_16113}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:25, 21 March 2018
Contents
Reaction BCor
- direction:
- REVERSIBLE
- common name:
- butanoyl-CoA:(acceptor) 2,3-oxidoreductase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 NAD[c] + 1.0 BUTYRYL-COA[c] <=> 1.0 PROTON[c] + 1.0 NADH[c] + 1.0 CROTONYL-COA[c]
- With common name(s):
- 1.0 NAD+[c] + 1.0 butanoyl-CoA[c] <=> 1.0 H+[c] + 1.0 NADH[c] + 1.0 crotonyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10643
- Source: orthology-creinhardtii
- Gene: Tiso_gene_16113
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii