Difference between revisions of "CPD-3188"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] == * smiles: ** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2)) * common name: ** N'-hyd...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2)) |
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** N'-hydroxymethyl-norcotinine |
| + | * inchi key: | ||
| + | ** InChIKey=GQUFOBHEPVFQMD-VIFPVBQESA-N | ||
| + | * molecular weight: | ||
| + | ** 192.217 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[RXN66-169]] |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201488 25201488] |
| − | {{#set: common name= | + | * HMDB : HMDB01324 |
| − | {{#set: | + | {{#set: smiles=C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2))}} |
| − | {{#set: | + | {{#set: common name=N'-hydroxymethyl-norcotinine}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=GQUFOBHEPVFQMD-VIFPVBQESA-N}} |
| + | {{#set: molecular weight=192.217 }} | ||
| + | {{#set: produced by=RXN66-169}} | ||
Latest revision as of 19:23, 21 March 2018
Contents
Metabolite CPD-3188
- smiles:
- C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2))
- common name:
- N'-hydroxymethyl-norcotinine
- inchi key:
- InChIKey=GQUFOBHEPVFQMD-VIFPVBQESA-N
- molecular weight:
- 192.217
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB01324
"C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2))" cannot be used as a page name in this wiki.
