Difference between revisions of "CPD-11525"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4) |
* common name: | * common name: | ||
| − | ** | + | ** OPC4-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J | ||
| + | * molecular weight: | ||
| + | ** 983.813 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-10707]] | |
| − | * [[RXN- | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-10700]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == Reaction(s) | + | |
| − | * [ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237211 44237211] |
| − | {{#set: | + | {{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}} |
| − | {{#set: | + | {{#set: common name=OPC4-CoA}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J}} |
| − | {{#set: | + | {{#set: molecular weight=983.813 }} |
| + | {{#set: consumed by=RXN-10707}} | ||
| + | {{#set: produced by=RXN-10700}} | ||
Latest revision as of 19:26, 21 March 2018
Contents
Metabolite CPD-11525
- smiles:
- CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
- common name:
- OPC4-CoA
- inchi key:
- InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J
- molecular weight:
- 983.813
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)" cannot be used as a page name in this wiki.
