Difference between revisions of "Tiso gene 4472"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17263 CPD-17263] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
 
(Created page with "Category:Gene == Gene Tiso_gene_4472 == * right end position: ** 13681 * transcription direction: ** POSITIVE * left end position: ** 11910 * centisome position: ** 80.451...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17263 CPD-17263] ==
+
== Gene Tiso_gene_4472 ==
* smiles:
+
* right end position:
** CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 13681
* inchi key:
+
* transcription direction:
** InChIKey=PCGPHLMAAZKQFQ-FPXDADDUSA-J
+
** POSITIVE
* common name:
+
* left end position:
** (8Z,11Z,14Z,17Z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-CoA
+
** 11910
* molecular weight:
+
* centisome position:
** 1065.958    
+
** 80.45123    
 
* Synonym(s):
 
* Synonym(s):
** 3-hydroxy-eicosatetraenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[DTDPDEHYRHAMREDUCT-RXN]]
* [[RXN-16020]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[DTDPRHAMSYN-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=13681}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819744 91819744]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=11910}}
{{#set: inchi key=InChIKey=PCGPHLMAAZKQFQ-FPXDADDUSA-J}}
+
{{#set: centisome position=80.45123   }}
{{#set: common name=(8Z,11Z,14Z,17Z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-CoA}}
+
{{#set: reaction associated=DTDPDEHYRHAMREDUCT-RXN}}
{{#set: molecular weight=1065.958   }}
+
{{#set: pathway associated=DTDPRHAMSYN-PWY}}
{{#set: common name=3-hydroxy-eicosatetraenoyl-CoA}}
+
{{#set: produced by=RXN-16020}}
+

Latest revision as of 19:23, 21 March 2018

Gene Tiso_gene_4472

  • right end position:
    • 13681
  • transcription direction:
    • POSITIVE
  • left end position:
    • 11910
  • centisome position:
    • 80.45123
  • Synonym(s):

Reactions associated

Pathways associated

External links